CAS 1807939-92-9

Bicyclo[4.1.0]heptan-2-amine, hydrochloride (1:1), (1R,6S)-rel-

Description:

Bicyclo[4.1.0]heptan-2-amine, hydrochloride (1:1), (1R,6S)-rel- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring system. The compound features an amine functional group, indicating its potential basicity and ability to form salts, such as the hydrochloride form. The specific stereochemistry, denoted by (1R,6S), suggests that the compound has defined spatial arrangements of its atoms, which can significantly influence its chemical reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. Its unique structural features and stereochemistry may also contribute to specific interactions with biological receptors or enzymes, making it a subject of interest in research and development.

Formula: C₇H₁₃N·ClH

InChI: InChI=1/C7H13N.ClH/c8-7-3-1-2-5-4-6(5)7;/h5-7H,1-4,8H2;1H/t5-,6+,7?;/s2

InChI key: InChIKey=WCVFUHDAUIXONO-MZVWTPGGNA-N

SMILES: NC1[C@]2([C@](C2)(CCC1)[H])[H].Cl

Synonyms:

• Bicyclo[4.1.0]heptan-2-amine, hydrochloride (1:1), (1R,6S)-rel-

rac-(1R,6S)-Bicyclo[4.1.0]heptan-2-amine hydrochloride

CAS: 1807939-92-9

Versatile small molecule scaffold

Formula: C₇H₁₄ClN

Purity: Min. 95%

Molecular weight: 147.6 g/mol

Ref: 3D-HXC93992