CAS 1807941-74-7

2-Butanol, 4-amino-, hydrochloride (1:1), (2R)-

Description:

2-Butanol, 4-amino-, hydrochloride (1:1), (2R)- is a chemical compound characterized by its amine and alcohol functional groups. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound features a butanol backbone with an amino group located at the fourth carbon, and the (2R) designation indicates its specific stereochemistry, which can influence its biological activity and interactions. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a building block in medicinal chemistry. Its hydrochloride form is often used to stabilize the compound and improve its handling and storage. Safety data should be consulted for proper handling, as with any chemical substance, to ensure safe laboratory practices. Overall, 2-Butanol, 4-amino-, hydrochloride (1:1), (2R)- is of interest in both research and industrial contexts due to its functional groups and structural characteristics.

Formula: C₄H₁₁NO·ClH

InChI: InChI=1S/C4H11NO.ClH/c1-4(6)2-3-5;/h4,6H,2-3,5H2,1H3;1H/t4-;/m1./s1

InChI key: InChIKey=MJFFBSGGCNBWLJ-PGMHMLKASA-N

SMILES: C([C@@H](C)O)CN.Cl

Synonyms:

• 2-Butanol, 4-amino-, hydrochloride (1:1), (2R)-

(R)-4-AMINOBUTAN-2-OL HCL

CAS: 1807941-74-7

Formula: C₄H₁₂ClNO

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 125.6

Ref: 10-F332780

(R)-4-Aminobutan-2-ol Hydrochloride

CAS: 1807941-74-7

Versatile small molecule scaffold

Formula: C₄H₁₁NO·HCl

Purity: Min. 95%

Molecular weight: 125.59 g/mol

Ref: 3D-HXC94174