CAS 180847-28-3
:1-(3-fluoropropyl)-4-(4-cyanophenoxymethyl)piperidine
Description:
1-(3-Fluoropropyl)-4-(4-cyanophenoxymethyl)piperidine, identified by its CAS number 180847-28-3, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a 3-fluoropropyl group and a 4-cyanophenoxymethyl group. The presence of the fluoropropyl moiety introduces a fluorine atom, which can influence the compound's lipophilicity and biological activity. The cyanophenoxymethyl group contributes to the compound's potential interactions with biological targets, possibly affecting its pharmacological properties. This compound may exhibit interesting characteristics such as solubility in organic solvents, stability under various conditions, and potential reactivity due to the functional groups present. Its specific applications and biological activities would depend on further studies, including pharmacokinetics and toxicity assessments, which are essential for understanding its potential use in medicinal chemistry or other fields.
Formula:C16H21FN2O
InChI:InChI=1/C16H21FN2O/c17-8-1-9-19-10-6-15(7-11-19)13-20-16-4-2-14(12-18)3-5-16/h2-5,15H,1,6-11,13H2
InChI key:KSMXCGCEJWKWOX-UHFFFAOYSA-N
SMILES:C(CF)CN1CCC(CC1)COc1ccc(cc1)C#N
Synonyms:- 1-Fpr-4-cnphomep
- 4-((1-(3-Fluoropropyl)-4-piperidinyl)methoxy)benzonitrile
- Benzonitrile, 4-((1-(3-fluoropropyl)-4-piperidinyl)methoxy)-
- 4-{[1-(3-Fluoropropyl)Piperidin-4-Yl]Methoxy}Benzonitrile
- 1-(3-Fluoropropyl)-4-(4-cyanophenoxymethyl)piperidine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzonitrile, 4-[[1-(3-fluoropropyl)-4-piperidinyl]methoxy]-
CAS:Formula:C16H21FN2OMolecular weight:276.3491
