CAS 18085-97-7
:Jaceosidin
Description:
Jaceosidin is a naturally occurring flavonoid compound primarily found in certain plants, particularly in the genus *Jaceospermum*. It is characterized by its unique chemical structure, which includes a flavone backbone, contributing to its potential biological activities. Jaceosidin has garnered interest in the field of pharmacology due to its reported antioxidant, anti-inflammatory, and anticancer properties. The compound exhibits a range of biological effects, including the ability to modulate various signaling pathways, which may contribute to its therapeutic potential. Additionally, Jaceosidin is known for its solubility in organic solvents, which can influence its bioavailability and efficacy in biological systems. Research into Jaceosidin continues to explore its mechanisms of action and potential applications in medicine, particularly in the development of natural products for health benefits. As with many phytochemicals, the specific effects and safety profiles of Jaceosidin require further investigation to fully understand its potential in clinical settings.
Formula:C17H14O7
InChI:InChI=1/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
InChI key:InChIKey=GLAAQZFBFGEBPS-UHFFFAOYSA-N
SMILES:OC1=C2C(OC(=CC2=O)C3=CC(OC)=C(O)C=C3)=CC(O)=C1OC
Synonyms:- 3′,6-Dimethoxy-4′,5,7-trihydroxyflavone
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-
- 4′,5,7-Trihydroxy-3′,6-dimethoxyflavone
- 4′-Demethyleupatilin
- 5,7,4′-Trihydroxy-6,3′-dimethoxyflavone
- 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
- 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one
- 6-Hydroxyluteolin 6,3′-dimethyl ether
- 6-Methoxyluteolin 3′-methyl ether
- Flavone, 4′,5,7-trihydroxy-3′,6-dimethoxy-
- Jaceosidin
- Jaseocidin
- Jaseosidin
- 4',5,7-Trihydroxy-3',6-dimethoxyflavone
- 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxychromen-4-one
- Jacosidin
- Jacesiolin
- 3',6-Dimethoxy-4',5,7-trihydroxyflavone
- 5,7-dihydroxy-2-(4-hydroxy-3-methoxy-phenyl)-6-methoxy-chromen-4-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-
CAS:Formula:C17H14O7Purity:%Color and Shape:SolidMolecular weight:330.2889Jaceosidin
CAS:Jaceosidin and Eupatilin are bioactive flavones found in the medicinal herbs of the genus Artemisia, exhibit various antioxidant, antiinflammatory, antiallergic, and antitumor activities, jaceosidin is a competitive inhibitor of CYP1A2 with a K(i) value of 3.8 microM and a mixed-type inhibitor of CYP2C9 with K(i) value of 6.4 microM in human liver microsomes.Formula:C17H14O7Purity:95%~99%Color and Shape:Yellow powderMolecular weight:330.292Jaceosidin
CAS:Jaceosidin: anti-oxidant, anti-inflammatory, anti-cancer, immunosuppressive; affects CYP1A2/UGT1A1/UGT1A7 metabolism.Formula:C17H14O7Purity:98.23% - 99.28%Color and Shape:SolidMolecular weight:330.29Jaceosidin
CAS:Oxygen-heterocyclic compoundFormula:C17H14O7Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:330.29Jaceosidin
CAS:<p>Jaceosidin is a flavonoid compound, which is derived from various plant species, notably those belonging to the genus Artemisia. This naturally occurring product is known for its diverse pharmacological effects, primarily due to its polyphenolic structure, which allows it to scavenge free radicals and modulate cell signaling pathways. The mode of action of jaceosidin involves inhibition of pro-inflammatory cytokine production and modulation of key signaling pathways such as NF-κB and MAPK. Additionally, it exhibits cytoprotective effects by enhancing the activity of antioxidant enzymes.</p>Formula:C17H14O7Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:330.29 g/mol5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one
CAS:Formula:C17H14O7Purity:99+%Molecular weight:330.292









