CAS 18087-73-5
:3-Bromoimidazo[1,2-b]pyridazine
Description:
3-Bromoimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, with a bromine substituent at the 3-position of the imidazole ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, making it useful in various chemical applications. The presence of the bromine atom enhances its reactivity, allowing for potential applications in medicinal chemistry and as a building block in the synthesis of more complex molecules. Its unique structure contributes to its biological activity, which may include antimicrobial or anticancer properties, although specific biological effects can vary based on the context of use. The compound's molecular structure also influences its physical properties, such as melting point and boiling point, which are essential for its handling and application in laboratory settings. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable compound in synthetic organic chemistry.
Formula:C6H4BrN3
InChI:InChI=1S/C6H4BrN3/c7-5-4-8-6-2-1-3-9-10(5)6/h1-4H
InChI key:InChIKey=KJQVHOFAWISYDO-UHFFFAOYSA-N
SMILES:BrC=1N2C(C=CC=N2)=NC1
Synonyms:- 3-Bromimidazo[1,2-b]pyridazin
- 3-Bromo-Imidazo[1,2-B]Pyridazine
- Imidazo[1,2-b]pyridazine, 3-bromo-
- 3-Bromoimidazo[1,2-b]pyridazine
- 3-bromoimidazo(1,2-b)pyridazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromoimidazo[1,2-b]pyridazine
CAS:Formula:C6H4BrN3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:198.02Imidazo[1,2-b]pyridazine, 3-bromo-
CAS:Formula:C6H4BrN3Purity:98%Color and Shape:SolidMolecular weight:198.02013-Bromoimidazo[1,2-b]pyridazine
CAS:3-Bromoimidazo[1,2-b]pyridazineFormula:C6H4BrN3Purity:98%Color and Shape: off-white to light brown solidMolecular weight:198.02g/mol3-Bromoimidazo[1,2-b]pyridazine
CAS:Formula:C6H4BrN3Purity:95%Color and Shape:SolidMolecular weight:198.0233-Bromoimidazo[1,2-b]pyridazine
CAS:3-Bromoimidazo[1,2-b]pyridazine (BIPM) is an analog of etoposide and has been shown to be a potent inhibitor of tyrosine kinases. BIPM selectively inhibits the activity of multikinase enzymes such as c-kit, PDGFRβ, and VEGFR2. In addition, BIPM has been shown to inhibit the proliferation of cancer cells by inducing apoptosis and cell cycle arrest in mcf-7 cells. This drug is not toxic to normal cells and shows a favorable safety profile when tested on animals.Formula:C6H4BrN3Purity:Min. 95%Molecular weight:198.02 g/mol




