CAS 18087-75-7

3-Nitroimidazo[1,2-b]pyridazine

Description:

3-Nitroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, with a nitro group positioned at the 3-position of the imidazole moiety. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential biological activity, particularly in the field of medicinal chemistry. It is often studied for its antimicrobial and antitumor properties, making it of interest in pharmaceutical research. The presence of the nitro group contributes to its reactivity and may influence its interaction with biological targets. In terms of solubility, compounds of this class may exhibit variable solubility in polar and non-polar solvents, which can affect their bioavailability and pharmacokinetics. Additionally, the compound's stability can be influenced by environmental factors such as pH and temperature. Overall, 3-Nitroimidazo[1,2-b]pyridazine represents a significant structure in the exploration of new therapeutic agents.

Formula: C₆H₄N₄O₂

InChI: InChI=1S/C6H4N4O2/c11-10(12)6-4-7-5-2-1-3-8-9(5)6/h1-4H

InChI key: InChIKey=YWTZZJSJUVSJKG-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1N2C(=NC1)C=CC=N2

Synonyms:

• 3-Nitroimidazo[1,2-b]pyridazin
• Imidazo[1,2-B]Pyridazine, 3-Nitro-
• 3-Nitroimidazo[1,2-b]pyridazine

Imidazo[1,2-b]pyridazine, 3-nitro-

CAS: 18087-75-7

Formula: C₆H₄N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.1216

Ref: IN-DA0022FK

3-Nitroimidazo[1,2-b]pyridazine

CAS: 18087-75-7

3-Nitroimidazo[1,2-b]pyridazine

Purity: 95%

Molecular weight: 164.12g/mol

Ref: 54-OR01792

3-Nitroimidazo[1,2-b]pyridazine

CAS: 18087-75-7

Purity: 95%

Molecular weight: 164.1239929

Ref: 10-F618475