CAS 18087-76-8

6-Chloro-3-nitroimidazo[1,2-b]pyridazine

Description:

6-Chloro-3-nitroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its unique bicyclic structure, which includes both imidazole and pyridazine rings. This compound features a chlorine atom and a nitro group, which contribute to its chemical reactivity and potential biological activity. The presence of the chlorine atom typically enhances lipophilicity, while the nitro group can serve as a site for reduction reactions, making it of interest in medicinal chemistry. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of antimicrobial agents or other therapeutic agents. Its molecular structure allows for various interactions with biological targets, which can be explored in drug design. Additionally, the compound's stability and solubility characteristics are essential for its practical applications in research and industry. As with many heterocycles, the electronic properties imparted by the substituents can influence its reactivity and interactions in biological systems.

Formula: C₆H₃ClN₄O₂

InChI: InChI=1S/C6H3ClN4O2/c7-4-1-2-5-8-3-6(11(12)13)10(5)9-4/h1-3H

InChI key: InChIKey=IJEZMDPWGDWYKJ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1N2C(=NC1)C=CC(Cl)=N2

Synonyms:

• 6-Chlor-3-nitroimidazo[1,2-b]pyridazin
• 6-Chloro-3-nitroimidazo[1,2-b]pyridazine
• Imidazo[1,2-b]pyridazine, 6-chloro-3-nitro-

Imidazo[1,2-b]pyridazine, 6-chloro-3-nitro-

CAS: 18087-76-8

Formula: C₆H₃ClN₄O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 198.5666

Ref: IN-DA0022FJ

6-Chloro-3-nitroimidazo[1,2-b]pyridazine

CAS: 18087-76-8

6-Chloro-3-nitroimidazo[1,2-b]pyridazine

Purity: 97%

Molecular weight: 198.57g/mol

Ref: 54-OR95885

6-Chloro-3-nitroimidazo[1,2-b]pyridazine

CAS: 18087-76-8

Formula: C₆H₃ClN₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.57

Ref: 10-F076311