CAS 1809-26-3
:4-Bromo-2-pentene
Description:
4-Bromo-2-pentene is an organic compound characterized by its alkene structure, featuring a double bond between the second and third carbon atoms in a five-carbon chain, with a bromine atom attached to the fourth carbon. Its molecular formula is C5H9Br, indicating the presence of five carbon atoms, nine hydrogen atoms, and one bromine atom. This compound is typically a colorless to pale yellow liquid at room temperature and has a distinct odor. It is known for its reactivity due to the presence of the double bond, making it a useful intermediate in organic synthesis, particularly in reactions such as electrophilic addition and substitution. The bromine substituent enhances its reactivity, allowing for further transformations in synthetic pathways. 4-Bromo-2-pentene is also of interest in studies related to stereochemistry, as it can exist in different geometric isomers. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H9Br
InChI:InChI=1S/C5H9Br/c1-3-4-5(2)6/h3-5H,1-2H3
InChI key:InChIKey=LIPODSDLKCMVON-UHFFFAOYSA-N
SMILES:C(C(Br)C)=CC
Synonyms:- 4-Bromo-2-pentene
- 1,3-Dimethallyl bromide
- 4-Bromopent-2-ene
- Piperylene hydrobromide
- 2-Pentene, 4-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
