CAS 18093-05-5

2-Chloro-4,5-dimethoxybenzaldehyde

Description:

2-Chloro-4,5-dimethoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group with two methoxy groups and a chlorine atom substituent. The presence of the chloro group at the second position and the methoxy groups at the fourth and fifth positions on the benzene ring significantly influence its chemical properties and reactivity. This compound is typically a pale yellow to light brown solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but less soluble in water due to its hydrophobic nature. It is often used in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The methoxy groups can participate in electrophilic aromatic substitution reactions, while the aldehyde group can undergo oxidation and condensation reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used.

Formula: C₉H₉ClO₃

InChI: InChI=1/C9H9ClO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-5H,1-2H3

SMILES: COc1cc(C=O)c(cc1OC)Cl

Benzaldehyde, 2-chloro-4,5-dimethoxy-

CAS: 18093-05-5

Formula: C₉H₉ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.6190

Ref: IN-DA0022HT

2-Chloro-4,5-dimethoxybenzaldehyde

CAS: 18093-05-5

2-Chloro-4,5-dimethoxybenzaldehyde

Purity: ≥95%

Color and Shape: Crystals

Molecular weight: 200.62g/mol

Ref: 54-OR52434

2-chloro-4,5-dimethoxybenzaldehyde

CAS: 18093-05-5

Formula: C₉H₉ClO₃

Purity: ≥95%

Molecular weight: 200.62

Ref: 10-F308356

2-Chloro-4,5-dimethoxybenzaldehyde

CAS: 18093-05-5

2-Chloro-4,5-dimethoxybenzaldehyde is a functional group that can be used as a nucleophile in organic synthesis. It has been shown to react with amines to produce nitro compounds. This functional group also reacts with acidic substances such as malic acid and ethanol extractions, forming chlorinated products. 2-Chloro-4,5-dimethoxybenzaldehyde can be extracted from the surface of plants using piperazine or morpholine.

Formula: C₉H₉ClO₃

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-TAA09305