CAS 181-28-2
:7,12-Dioxaspiro[5.6]dodecane
Description:
7,12-Dioxaspiro[5.6]dodecane, with the CAS number 181-28-2, is a bicyclic organic compound characterized by its unique spiro structure, which consists of two rings that share a single atom. This compound features two ether functional groups, contributing to its chemical reactivity and solubility properties. Typically, dioxaspiro compounds exhibit interesting conformational dynamics due to the strain introduced by the spiro linkage. The presence of oxygen atoms in the structure can enhance its polarity compared to purely hydrocarbon compounds, affecting its interactions with other substances. 7,12-Dioxaspiro[5.6]dodecane may be utilized in various applications, including organic synthesis and as a potential intermediate in the production of more complex molecules. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the presence of functional groups. Overall, this compound exemplifies the diversity of chemical structures and their potential applications in synthetic chemistry.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-2-6-10(7-3-1)11-8-4-5-9-12-10/h1-9H2
InChI key:InChIKey=GGKFOZUGYBUSAD-UHFFFAOYSA-N
SMILES:C12(OCCCCO1)CCCCC2
Synonyms:- 7,12-Dioxaspiro[5.6]dodecane
- 7,12-Dioxaspiro(5.6)dodecane
- Cyclohexanone cyclic tetramethylene acetal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
