CAS 1810070-01-9

Benzenebutanoic acid, γ-amino-4-methyl-, hydrochloride (1:1)

Description:

Benzenebutanoic acid, γ-amino-4-methyl-, hydrochloride (1:1), identified by the CAS number 1810070-01-9, is a chemical compound that features a benzene ring substituted with a butanoic acid moiety and an amino group at the gamma position relative to the carboxylic acid. This compound is characterized by its hydrochloride salt form, which enhances its solubility in water and may influence its biological activity. The presence of the amino group suggests potential for interactions with biological systems, making it of interest in pharmaceutical applications. The methyl group on the benzene ring can affect the compound's steric and electronic properties, potentially influencing its reactivity and interaction with other molecules. As a hydrochloride salt, it typically exhibits improved stability and ease of handling compared to its free base form. Overall, this compound's unique structure may confer specific properties that are valuable in medicinal chemistry and related fields.

Formula: C₁₁H₁₅NO₂·ClH

InChI: InChI=1S/C11H15NO2.ClH/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H

InChI key: InChIKey=UEXGINOZWJGYAC-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)(N)C1=CC=C(C)C=C1.Cl

Synonyms:

• Benzenebutanoic acid, γ-amino-4-methyl-, hydrochloride (1:1)

4-Amino-4-(4-methylphenyl)butanoic acid-hcl

CAS: 1810070-01-9

Formula: C₁₁H₁₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 229.7032

Ref: IN-DA0022K9

4-Amino-4-(p-tolyl)butanoic acid hydrochloride

CAS: 1810070-01-9

4-Amino-4-(p-tolyl)butanoic acid hydrochloride

Purity: 95%

Molecular weight: 229.71g/mol

Ref: 54-OR1050845

4-AMINO-4-(4-METHYLPHENYL)BUTANOIC ACID-HCL

CAS: 1810070-01-9

Formula: C₁₁H₁₆ClNO₂

Purity: 95%

Molecular weight: 229.7

Ref: 10-F513849