CAS 1810070-25-7
:Isoquinoline, 6-bromo-, hydrochloride (1:1)
Description:
Isoquinoline, 6-bromo-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure containing a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position of the isoquinoline ring introduces notable electrophilic properties and can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit biological activities, potentially serving as a precursor or intermediate in the synthesis of other bioactive molecules. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, isoquinoline derivatives are significant in the development of therapeutic agents, and the 6-bromo substitution may impart unique properties that warrant further investigation.
Formula:C9H6BrN·ClH
InChI:InChI=1S/C9H6BrN.ClH/c10-9-2-1-8-6-11-4-3-7(8)5-9;/h1-6H;1H
InChI key:InChIKey=NNGJJGYJBKXZGW-UHFFFAOYSA-N
SMILES:BrC1=CC2=C(C=C1)C=NC=C2.Cl
Synonyms:- Isoquinoline, 6-bromo-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
