CAS 18101-58-1
:2-Amino-1,3-benzothiazole-6-Sulfonamide
Description:
2-Amino-1,3-benzothiazole-6-sulfonamide, with the CAS number 18101-58-1, is a chemical compound that features a benzothiazole core substituted with an amino group and a sulfonamide group. This compound is characterized by its heterocyclic structure, which includes both sulfur and nitrogen atoms, contributing to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents, which is common for sulfonamide derivatives. The presence of the sulfonamide group imparts acidic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, its structural features may allow for interactions with biological targets, making it a candidate for further pharmacological studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C7H7N3O2S2
InChI:InChI=1/C7H7N3O2S2/c8-7-10-5-2-1-4(14(9,11)12)3-6(5)13-7/h1-3H,(H2,8,10)(H2,9,11,12)
SMILES:c1cc2c(cc1S(=O)(=O)N)sc(=N)[nH]2
Synonyms:- 6-Benzothiazolesulfonamide, 2-Amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Benzothiazolesulfonamide, 2-amino-
CAS:Formula:C7H7N3O2S2Purity:95%Color and Shape:SolidMolecular weight:229.27942-Amino-1,3-benzothiazole-6-sulfonamide
CAS:2-Amino-1,3-benzothiazole-6-sulfonamidePurity:95%Molecular weight:229.28g/mol2-Amino-benzothiazole-6-sulfonic acid amide
CAS:Formula:C7H7N3O2S2Purity:95%Color and Shape:SolidMolecular weight:229.272-Amino-benzothiazole-6-sulfonic acid amide
CAS:<p>2-Amino-benzothiazole-6-sulfonic acid amide is a drug that belongs to the class of anhydrase inhibitors. It has been found to have a potent inhibitory effect on carbonic anhydrase, which is thought to be involved in the pathogenesis of some cancers. This drug has also been shown to have antiviral effects against HIV and Herpes simplex virus type 1, as well as antibacterial activity against Entamoeba histolytica and Giardia lamblia. 2-Amino-benzothiazole-6-sulfonic acid amide has been shown to reduce inflammation by inhibiting immunodeficiency, which may be due to its inhibition of the enzyme carrageenan synthase. The carrageenan synthase enzyme is required for the production of polysaccharides found in red blood cells and microorganisms that are involved in inflammatory processes.</p>Formula:C7H7N3O2S2Purity:Min. 95%Molecular weight:229.28 g/mol



