CAS 18103-42-9
:5,7-Dihydroxy-3′,4′,5′-trimethoxyflavone
Description:
5,7-Dihydroxy-3′,4′,5′-trimethoxyflavone, with the CAS number 18103-42-9, is a flavonoid compound characterized by its polyphenolic structure, which includes multiple hydroxyl and methoxy groups. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, such as ethanol and methanol, but may have limited solubility in water. The presence of hydroxyl groups contributes to its antioxidant properties, making it of interest in various biological and pharmacological studies. Flavonoids like this one are known for their potential health benefits, including anti-inflammatory, anti-cancer, and cardioprotective effects. The specific arrangement of methoxy groups on the flavonoid backbone influences its biological activity and interaction with cellular pathways. Additionally, this compound may be found in certain plants and herbs, contributing to their medicinal properties. As with many flavonoids, further research is ongoing to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C18H16O7
InChI:InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3
InChI key:InChIKey=CPCPHNWWTJLXKQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(OC)=C(OC)C(OC)=C3)=CC(O)=CC2O
Synonyms:- 3′,4′,5′-Tri-O-methyl-tricetin
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-
- 5,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)-4-Benzopyrone
- 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one
- 5,7-Dihydroxy-3',4',5'-Trimethoxyflavone With Hplc
- 5,7-Dihydroxy-3',4',5'-trimethoxy
- 5,7-Dihydroxy-3′,4′,5′-trimethoxyflavone
- 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one
- Dihydroxy-3',4',5'-Trimethoxyflavone, 5,7-
- Flavone, 5,7-dihydroxy-3′,4′,5′-trimethoxy-
- Nsc 123410
- Tricetin 3′,4′,5′-trimethyl ether
- Tricin Methyl Ether
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5,7-Dihydroxy-3',4',5'-trimethoxyflavone
CAS:5,7-Dihydroxy-3',4',5'-trimethoxyflavone analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C18H16O7Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:344.335,7-Dihydroxy-3',4',5'-trimethoxyflavone
CAS:5,7-Dihydroxy-3',4',5'-trimethoxyflavone is a natural product from Centaurea scoparia.Formula:C18H16O7Purity:98%Color and Shape:SolidMolecular weight:344.32Tricin 4'-methyl ether
CAS:<p>Tricin 4'-methyl ether is a bioactive flavonoid, which is a phytochemical compound primarily derived from various plant sources such as rice, wheat, and maize. This compound is known for its antioxidant properties due to its phenolic structure, which allows it to scavenge free radicals and reduce oxidative stress. Additionally, Tricin 4'-methyl ether exhibits potential anti-inflammatory effects by modulating the activity of specific enzymes and pathways involved in inflammation.</p>Formula:C18H16O7Purity:Min. 95%Color and Shape:PowderMolecular weight:344.32 g/mol




