CAS 181039-99-6

Methyl α-bromo-2-(trifluoromethyl)benzeneacetate

Description:

Methyl α-bromo-2-(trifluoromethyl)benzeneacetate is an organic compound characterized by its unique functional groups and structural features. It contains a bromine atom and a trifluoromethyl group, which significantly influence its reactivity and physical properties. The presence of the bromine atom suggests potential for nucleophilic substitution reactions, while the trifluoromethyl group enhances the compound's lipophilicity and can affect its electronic properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and material science. The ester functional group in the molecule also indicates that it can undergo hydrolysis or transesterification reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its bromine and fluorine content. Overall, Methyl α-bromo-2-(trifluoromethyl)benzeneacetate is a versatile intermediate in organic synthesis.

Formula: C₁₀H₈BrF₃O₂

InChI: InChI=1S/C10H8BrF3O2/c1-16-9(15)8(11)6-4-2-3-5-7(6)10(12,13)14/h2-5,8H,1H3

InChI key: InChIKey=BRBOEALBFMVDME-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(Br)C1=C(C(F)(F)F)C=CC=C1

Synonyms:

• Benzeneacetic acid, α-bromo-2-(trifluoromethyl)-, methyl ester
• Methyl α-bromo-2-(trifluoromethyl)benzeneacetate

Methyl 2-bromo-2-[2-(trifluoromethyl)phenyl]acetate

CAS: 181039-99-6

Versatile small molecule scaffold

Formula: C₁₀H₈BrF₃O₂

Purity: Min. 95%

Molecular weight: 297.07 g/mol

Ref: 3D-GHA03999