
CAS 181069-80-7
:Thiazolium, 4,5-dimethyl-3-(2-oxo-2-phenylethyl)-, bromide (1:1)
Description:
Thiazolium, 4,5-dimethyl-3-(2-oxo-2-phenylethyl)-, bromide (1:1), with CAS number 181069-80-7, is a chemical compound characterized by its thiazolium ring structure, which is a five-membered heterocyclic ring containing sulfur and nitrogen. This compound features a dimethyl substitution at the 4 and 5 positions of the thiazolium ring, enhancing its stability and reactivity. The presence of a 2-oxo-2-phenylethyl group contributes to its potential as a reactive intermediate in various organic synthesis applications. As a bromide salt, it is typically soluble in polar solvents, which can facilitate its use in chemical reactions. Thiazolium salts are often utilized in catalysis, particularly in reactions involving the formation of carbon-carbon bonds. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other reagents in a reaction mixture.
Formula:C13H14NOS·Br
InChI:InChI=1S/C13H14NOS.BrH/c1-10-11(2)16-9-14(10)8-13(15)12-6-4-3-5-7-12;/h3-7,9H,8H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=NWYBJPXXICNVLX-UHFFFAOYSA-M
SMILES:C(C(=O)C1=CC=CC=C1)[N+]=2C(C)=C(C)SC2.[Br-]
Synonyms:- ALT 711
- Thiazolium, 4,5-dimethyl-3-(2-oxo-2-phenylethyl)-, bromide (1:1)
- Thiazolium, 4,5-dimethyl-3-(2-oxo-2-phenylethyl)-, bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Alagebrium bromide
CAS:Alagebrium is a advanced glycation endproducts (AGE) cross-link breaker.Formula:C13H14BrNOSColor and Shape:SolidMolecular weight:312.23
