CAS 1811-28-5: 3,6-Acridinediamine, sulfate (2:1)
Description:3,6-Acridinediamine, sulfate (2:1), with the CAS number 1811-28-5, is a chemical compound characterized by its structure, which includes an acridine backbone with two amino groups at the 3 and 6 positions. This compound is typically encountered as a sulfate salt, indicating that it forms a stable ionic compound with sulfate ions. It is known for its potential applications in various fields, including pharmaceuticals and dye manufacturing, due to the reactivity of the amino groups that can participate in further chemical modifications. The presence of the acridine moiety contributes to its unique optical and electronic properties, making it of interest in organic electronics and photonic applications. Additionally, the compound may exhibit biological activity, which warrants investigation for potential therapeutic uses. Safety data should be reviewed, as with any chemical, to understand its handling, toxicity, and environmental impact. Overall, 3,6-Acridinediamine, sulfate (2:1) is a versatile compound with significant implications in both industrial and research settings.
Formula:C13H11N3H2O4S
InChI:InChI=1S/C13H11N3.H2O4S/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;1-5(2,3)4/h1-7H,14-15H2;(H2,1,2,3,4)
InChI key:InChIKey=WSFHCKWLECYVBS-UHFFFAOYSA-N
SMILES:O=S(=O)(O)O.N=1C=2C=C(N)C=CC2C=C3C=CC(N)=CC13
- Synonyms:
- 3,6-Acridinediamine, sulfate (2:1)
- Acridine-3,6-Diamine Sulfate (2:1) Hydrate
- Bis(6-Aminoacridin-3-Aminium) Sulfate
- Proflavine Hemisulphate
- Acridine-3,6-diamine hemisulfate
