CAS 1811-85-4
:3-(2,4-DIMETHYLPHENYL)PROPIONIC ACID
Description:
3-(2,4-Dimethylphenyl)propionic acid, with the CAS number 1811-85-4, is an organic compound characterized by its propionic acid structure substituted with a 2,4-dimethylphenyl group. This compound typically appears as a white to off-white crystalline solid. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic carboxylic acids. The presence of the dimethylphenyl group contributes to its hydrophobic characteristics, influencing its reactivity and interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its melting point and boiling point can vary based on purity and specific conditions. As with many organic acids, it can participate in acid-base reactions and may serve as a precursor or intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.
Formula:C11H14O2
InChI:InChI=1/C11H14O2/c1-8-3-4-10(9(2)7-8)5-6-11(12)13/h3-4,7H,5-6H2,1-2H3,(H,12,13)
SMILES:Cc1ccc(CCC(=O)O)c(C)c1
Synonyms:- 3-(2,4-Dimethylphenyl)Propanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenepropanoic acid, 2,4-dimethyl-
CAS:Formula:C11H14O2Purity:97%Color and Shape:SolidMolecular weight:178.22773-(2,4-Dimethylphenyl)propionic acid
CAS:3-(2,4-Dimethylphenyl)propionic acid
Molecular weight:178.22766g/mol3-(2,4-Dimethylphenyl)propionic acid
CAS:3-(2,4-Dimethylphenyl)propionic acid is an organic compound that belongs to the class of propionic acid derivatives. It is a chiral compound with two stereoisomers. The crystal structure of the racemic mixture has been determined by x-ray crystallography and the absolute configuration was assigned as (S) based on its enantiomeric excess. 3-(2,4-Dimethylphenyl)propionic acid can be synthesized from benzyloxymethyl chloride and propionic acid. This reaction is mediated by a base, such as sodium methoxide or potassium t-butoxide.
3-(2,4-Dimethylphenyl)propionic acid is used in the synthesis of other compounds, such as phenylethyl propionate and 2-methylbenzaldehyde.Formula:C11H14O2Purity:Min. 95%Molecular weight:178.23 g/molRef: 3D-BAA81185
Discontinued product




