CAS 18112-46-4

2-hydroxy-1-(1H-indol-3-yl)propan-1-one

Description:

2-Hydroxy-1-(1H-indol-3-yl)propan-1-one, also known as indole-3-acetic acid derivative, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a hydroxyl group (-OH) and a ketone group (C=O) attached to a propan-1-one backbone, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry and plant biology, as it may play a role in plant growth regulation and has potential pharmacological properties. Its molecular structure allows for interactions with biological systems, making it a subject of study for its effects on cellular processes. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c1-7(13)11(14)9-6-12-10-5-3-2-4-8(9)10/h2-7,12-13H,1H3

SMILES: CC(C(=O)c1c[nH]c2ccccc12)O

2-Hydroxy-1-(1H-indol-3-yl)propan-1-one

Controlled Product

CAS: 18112-46-4

Versatile small molecule scaffold

Formula: C₁₁H₁₁NO₂

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-TAA11246