CAS 181124-40-3

1,3-Benzothiazole-6-sulfonyl chloride

Description:

1,3-Benzothiazole-6-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a benzothiazole ring system. This compound typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the preparation of sulfonamide derivatives and other biologically active compounds. The compound is soluble in polar organic solvents, and its reactivity makes it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions are necessary when handling this substance, as it can be corrosive and may release toxic gases upon hydrolysis. Overall, 1,3-Benzothiazole-6-sulfonyl chloride is an important building block in medicinal chemistry and materials science, contributing to the development of various chemical entities.

Formula: C₇H₄ClNO₂S₂

InChI: InChI=1/C7H4ClNO2S2/c8-13(10,11)5-1-2-6-7(3-5)12-4-9-6/h1-4H

SMILES: c1cc2c(cc1S(=O)(=O)Cl)scn2

6-Benzothiazolesulfonyl chloride

CAS: 181124-40-3

Formula: C₇H₄ClNO₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 233.6952

Ref: IN-DA0022P0

1,3-Benzothiazole-6-sulphonyl chloride

CAS: 181124-40-3

1,3-Benzothiazole-6-sulphonyl chloride

Formula: C₇H₄ClNO₂S₂

Purity: 95%

Color and Shape: pale yellow. crystalline powder or crystals

Molecular weight: 233.70g/mol

Ref: 54-OR14303

6-Benzothiazolesulfonyl chloride

CAS: 181124-40-3

Formula: C₇H₄ClNO₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 233.68

Ref: 10-F033233