CAS 181135-58-0
:Cymal 3
Description:
Cymal 3, with the CAS number 181135-58-0, is a synthetic surfactant belonging to the class of glyceryl monooleate derivatives. It is primarily used in pharmaceutical formulations and cosmetic products due to its emulsifying and stabilizing properties. This compound is characterized by its ability to enhance the solubility of hydrophobic substances, making it valuable in the formulation of creams, lotions, and other topical applications. Cymal 3 exhibits low toxicity and is generally regarded as safe for use in various applications. Its amphiphilic nature allows it to interact with both aqueous and lipid phases, facilitating the formation of stable emulsions. Additionally, it can improve the bioavailability of active ingredients in drug formulations. As with many surfactants, the effectiveness of Cymal 3 can be influenced by factors such as concentration, temperature, and the presence of other formulation components. Overall, Cymal 3 is a versatile ingredient that plays a crucial role in enhancing the performance and stability of various products in the pharmaceutical and cosmetic industries.
Formula:C21H38O11
InChI:InChI=1S/C21H38O11/c22-9-12-14(24)15(25)17(27)21(30-12)32-19-13(10-23)31-20(18(28)16(19)26)29-8-4-7-11-5-2-1-3-6-11/h11-28H,1-10H2/t12-,13-,14-,15+,16-,17-,18-,19-,20-,21-/m1/s1
InChI key:InChIKey=FDBLAHXBTQUZSM-ZESVGKPKSA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@@H](OCCCC2CCCCC2)[C@H](O)[C@H]1O)[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- 3-Cyclohexylpropyl 4-O-Alpha-D-Glucopyranosyl-Beta-D-Glucopyranoside
- 3-Cyclohexylpropyl 4-O-α-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranoside
- 3-Cyclohexylpropyl-4-O-(a-D-glucopyranosyl)-b-D-glucopyranoside
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 3-cyclohexylpropyl 4-O-α-<smallcap>D</span>-glucopyranosyl-
- Cymal 3
- β-D-Glucopyranoside, 3-cyclohexylpropyl 4-O-α-D-glucopyranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-D-Glucopyranoside, 3-cyclohexylpropyl 4-O-α-D-glucopyranosyl-
CAS:Formula:C21H38O11Molecular weight:466.51983-Cyclohexylpropyl-4-O-(a-D-glucopyranosyl)-b-D-glucopyranoside
CAS:3-Cyclohexylpropyl-4-O-(a-D-glucopyranosyl)-b-D-glucopyranoside is a solubilized form of epidermal growth factor (EGF) that binds to the epidermal growth factor receptor. It has been shown to stimulate epidermal growth and increase the rate of cellular proliferation in human epidermis. 3-Cyclohexylpropyl-4-O-(a-D-glucopyranosyl)-b-D-glucopyranoside may also have structural roles in mitochondrial matrix, ligand binding, and energy metabolism. Further study is needed to determine the role of this drug in these processes.Formula:C21H38O11Purity:Min. 95%Molecular weight:466.52 g/mol


