CymitQuimica logo

CAS 181144-66-1

:

4-(4-Fluorophenoxy)benzaldehyde semicarbazone

Description:
4-(4-Fluorophenoxy)benzaldehyde semicarbazone is an organic compound characterized by its semicarbazone functional group, which is formed by the reaction of semicarbazide with an aldehyde. This compound features a fluorophenoxy group, indicating the presence of a fluorine atom on a phenyl ring that is ether-linked to another phenyl ring bearing an aldehyde functional group. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. Typically, semicarbazones are known for their applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to form stable complexes with metal ions and their potential biological activity. The compound may exhibit various physical properties such as melting point, boiling point, and solubility, which are influenced by its molecular structure. Additionally, it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its identity and purity.
Formula:C14H12FN3O2
InChI:InChI=1/C14H12FN3O2/c15-11-3-7-13(8-4-11)20-12-5-1-10(2-6-12)9-17-18-14(16)19/h1-9H,(H3,16,18,19)/b17-9+
InChI key:MHUUDVZSPFRUSK-RQZCQDPDSA-N
SMILES:C1=CC(=CC=C1/C=N/NC(=O)N)OC2=CC=C(C=C2)F
Synonyms:
  • V-102862
  • Co-102862
  • (2E)-2-[4-(4-fluorophenoxy)benzylidene]hydrazinecarboxamide
Found 4 products.