CAS 181214-74-4
:1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-methoxypentane
Description:
1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-methoxypentane is a fluorinated organic compound characterized by a long carbon chain with multiple fluorine substituents and a methoxy group. This compound features a total of eleven fluorine atoms, which significantly influence its physical and chemical properties, such as high thermal stability, low surface tension, and low reactivity. The presence of the methoxy group introduces an ether functionality, which can affect solubility and polarity. Typically, such fluorinated compounds exhibit low volatility and high resistance to degradation, making them useful in various applications, including as solvents or in specialty chemical formulations. Additionally, their unique properties may render them suitable for use in advanced materials or as intermediates in chemical synthesis. However, the environmental impact and potential toxicity of perfluorinated compounds are important considerations, as they can persist in the environment and bioaccumulate. Overall, this compound exemplifies the complex interplay between structure and function in fluorinated organic chemistry.
Formula:C6H3F11O
InChI:InChI=1/C6H3F11O/c1-18-6(16,17)4(11,12)2(7,8)3(9,10)5(13,14)15/h1H3
SMILES:COC(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- Methyl undecafluoropentyl ether
- Pentane, 1,1,1,2,2,3,3,4,4,5,5-Undecafluoro-5-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
