CAS 181283-83-0

5-Amino-6-quinolinecarboxylic acid

Description:

5-Amino-6-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the quinoline ring, contributing to its potential as a versatile building block in medicinal chemistry and organic synthesis. It is typically a crystalline solid, exhibiting solubility in polar solvents due to the presence of the carboxylic acid group. The compound may display various biological activities, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. Its molecular structure allows for potential interactions with biological targets, and it may undergo various chemical reactions, such as acylation or alkylation, to form derivatives with enhanced properties. As with many quinoline derivatives, the compound's properties can be influenced by substituents and the overall molecular environment, making it a subject of study in both synthetic and medicinal chemistry.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1S/C10H8N2O2/c11-9-6-2-1-5-12-8(6)4-3-7(9)10(13)14/h1-5H,11H2,(H,13,14)

InChI key: InChIKey=IUSQIFIDQPWBAJ-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=CC1C(O)=O)N=CC=C2

Synonyms:

• 5-Amino-6-quinolinecarboxylic acid
• 6-Quinolinecarboxylic acid, 5-amino-
• 5-Aminoquinoline-6-carboxylic acid
• 5-Amino-6-carboxyquinoline