CAS 1813-29-2
:4-methylphenyl trifluoroacetate
Description:
4-Methylphenyl trifluoroacetate, with the CAS number 1813-29-2, is an organic compound characterized by the presence of a trifluoroacetate functional group attached to a para-substituted methylphenyl ring. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The trifluoroacetate moiety contributes to its reactivity, making it useful in various chemical reactions, including esterification and acylation processes. Additionally, the presence of the trifluoromethyl group enhances its stability and lipophilicity, which can influence its behavior in biological systems. As with many organic compounds, safety precautions should be taken when handling 4-methylphenyl trifluoroacetate, as it may pose health risks through inhalation or skin contact. Overall, this compound is of interest in synthetic organic chemistry and may find applications in pharmaceuticals and agrochemicals.
Formula:C9H7F3O2
InChI:InChI=1/C9H7F3O2/c1-6-2-4-7(5-3-6)14-8(13)9(10,11)12/h2-5H,1H3
SMILES:Cc1ccc(cc1)OC(=O)C(F)(F)F
Synonyms:- p-Tolyl trifluoroacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
