CymitQuimica logo

CAS 181434-85-5

:

L-Arginine, N2-(1-oxododecyl)-, hydrochloride (1:1)

Description:
L-Arginine, N2-(1-oxododecyl)-, hydrochloride (1:1) is a derivative of the amino acid L-arginine, which plays a crucial role in protein synthesis and various metabolic processes. This compound features a dodecyl chain, contributing to its hydrophobic characteristics, while the hydrochloride form enhances its solubility in aqueous environments. The presence of the oxododecyl group suggests potential applications in drug delivery or as a surfactant due to its amphiphilic nature. L-arginine itself is known for its involvement in nitric oxide production, which is vital for vascular health. The hydrochloride salt form typically improves stability and bioavailability. This compound may exhibit biological activities related to cardiovascular health, immune function, and wound healing, making it of interest in pharmaceutical and nutritional contexts. As with many amino acid derivatives, its safety profile and efficacy would depend on dosage and specific application, necessitating further research to fully understand its potential benefits and mechanisms of action.
Formula:C18H36N4O3·ClH
InChI:InChI=1S/C18H36N4O3.ClH/c1-2-3-4-5-6-7-8-9-10-13-16(23)22-15(17(24)25)12-11-14-21-18(19)20;/h15H,2-14H2,1H3,(H,22,23)(H,24,25)(H4,19,20,21);1H/t15-;/m0./s1
InChI key:InChIKey=KXPNNVVJPXCUQN-RSAXXLAASA-N
SMILES:[C@H](NC(CCCCCCCCCCC)=O)(CCCNC(=N)N)C(O)=O.Cl
Synonyms:
  • L-Arginine, N2-(1-oxododecyl)-, monohydrochloride
  • L-Arginine, N2-(1-oxododecyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.