CAS 181467-56-1
:5-{[1-({[(4S)-4,11-diethyl-4-hydroxy-3,14-dioxo-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl]oxy}carbonyl)piperidin-4-yl]amino}pentanoic acid
Description:
The chemical substance known as 5-{[1-({[(4S)-4,11-diethyl-4-hydroxy-3,14-dioxo-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl]oxy}carbonyl)piperidin-4-yl]amino}pentanoic acid, with the CAS number 181467-56-1, is a complex organic compound characterized by its intricate molecular structure. It features multiple functional groups, including a pentanoic acid moiety, a piperidine ring, and a pyranoindolizinoquinoline core, which contribute to its potential biological activity. The presence of hydroxyl and carbonyl groups suggests it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry due to its structural complexity, which may correlate with specific pharmacological properties. Its synthesis and characterization would require advanced techniques in organic chemistry, and its potential applications could span various fields, including drug development and biochemical research. However, detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C33H38N4O8
InChI:InChI=1/C33H38N4O8/c1-3-21-22-15-20(45-32(42)36-13-10-19(11-14-36)34-12-6-5-7-28(38)39)8-9-26(22)35-29-23(21)17-37-27(29)16-25-24(30(37)40)18-44-31(41)33(25,43)4-2/h8-9,15-16,19,34,43H,3-7,10-14,17-18H2,1-2H3,(H,38,39)/t33-/m0/s1
SMILES:CCc1c2cc(ccc2nc2c1Cn1c2cc2c(COC(=O)[C@@]2(CC)O)c1=O)OC(=O)N1CCC(CC1)NCCCCC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Piperidinecarboxylic acid, 4-[(4-carboxybutyl)amino]-, (4S)-4,11-diethyl-3,4,12,14-tetrahydro-4-hydroxy-3,14-dioxo-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl ester
CAS:Formula:C33H38N4O8Purity:99.59%Color and Shape:SolidMolecular weight:618.6768RPR121056
CAS:RPR121056 is a Irinotecan metabolite, which is generated by CYP3A4. Irinotecan is an antineoplastic agent that inhibits topoisomerase type I.Formula:C33H38N4O8Purity:98%Color and Shape:SolidMolecular weight:618.687-Ethyl-10-(4-N-aminopentanoic acid)-1-piperidino)carbonyloxycamptothecin
CAS:Controlled Product<p>Applications A major metabolite of Irinotecan.<br>References Canal, P., et al.: J. Clin. Oncol., 14, 2688 (1996), Haaz, M., et al.: Cancer Res., 58, 468 (1998), Kehrer, D., et al.: Clin. Cancer Res., 6, 3451 (2000), Hanioka, N., et al.: Xenobiotica, 31, 687 (2001), Satoh, T., et al.: Drug Metab. Dispos., 30, 488 (2002),<br></p>Formula:C33H38N4O8Color and Shape:Light YellowMolecular weight:618.6768



