CAS 1814901-04-6

4,7,10,16,19,22-Hexaoxa-13-azapentacosanedioic acid

Description:

4,7,10,16,19,22-Hexaoxa-13-azapentacosanedioic acid is a complex organic compound characterized by its unique structure, which includes multiple ether linkages and an amine functional group. This compound features a long carbon chain, making it a polyether with significant hydrophilicity due to the presence of multiple oxygen atoms in its structure. The azapentacosanedioic acid component indicates that it contains both amine and carboxylic acid functionalities, which can impart interesting chemical reactivity and potential applications in various fields, including materials science and biochemistry. The presence of multiple ether groups suggests that it may exhibit good solubility in polar solvents and could be used in the synthesis of polymers or as a surfactant. Additionally, the structural complexity may allow for specific interactions with biological systems, making it a candidate for research in drug delivery or as a biochemical probe. Overall, this compound's unique characteristics stem from its intricate molecular architecture, which combines both hydrophilic and hydrophobic elements.

Formula: C₁₈H₃₅NO₁₀

InChI: InChI=1S/C18H35NO10/c20-17(21)1-5-24-9-13-28-15-11-26-7-3-19-4-8-27-12-16-29-14-10-25-6-2-18(22)23/h19H,1-16H2,(H,20,21)(H,22,23)

InChI key: InChIKey=SOBFCIHPQNRZEE-UHFFFAOYSA-N

SMILES: C(CC(O)=O)OCCOCCOCCNCCOCCOCCOCCC(O)=O

Synonyms:

• 4,7,10,16,19,22-Hexaoxa-13-azapentacosanedioic acid

NH-bis(PEG3-acid) HCl salt

CAS: 1814901-04-6

Formula: C₁₈H₃₅NO₁₀

Purity: 95%

Color and Shape: Liquid

Molecular weight: 425.4712

Ref: IN-DA019E6W

NH-bis(PEG3-acid)

CAS: 1814901-04-6

NH-bis(PEG3-acid) is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₈H₃₅NO₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 425.47

Ref: TM-T18482

Acid-apeg6-acid

CAS: 1814901-04-6

Acid-apeg6-acid

Purity: 95%

Molecular weight: 425.48g/mol

Ref: 54-OR1071368

NH-bis(PEG3-acid) hydrochloride

CAS: 1814901-04-6

NH-bis(PEG3-acid) hydrochloride is a PEG polymer categorised as multi-arm PEGs, a group of polyethylene glycol derivatives with multiple PEG chains. NH-bis(PEG3-acid) hydrochloride is a linker used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₁₈H₃₅NO₁₀

Purity: Min. 95%

Molecular weight: 425.5 g/mol

Ref: 3D-PXC90104