CAS 181517-13-5
:2,4(1H,3H)-Pyrimidinedione-2-13C-1,3-15N2, 5-bromo-
Description:
2,4(1H,3H)-Pyrimidinedione-2-13C-1,3-15N2, 5-bromo- is a chemically modified pyrimidine derivative, characterized by the presence of isotopes and a bromine substituent. The compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of the 13C isotope indicates that one of the carbon atoms in the molecule is a stable carbon isotope, while the 15N isotopes signify that two nitrogen atoms are labeled with this stable nitrogen isotope. The bromine atom at the 5-position introduces a halogen, which can influence the compound's reactivity and biological activity. This compound is likely to be of interest in biochemical and pharmaceutical research, particularly in studies involving nucleic acids or as a potential therapeutic agent. Its unique isotopic labeling can also be useful in tracing studies or in understanding metabolic pathways. As with many pyrimidine derivatives, it may exhibit properties such as solubility in polar solvents and potential interactions with biological macromolecules.
Formula:C4H3BrN2O2
InChI:InChI=1S/C4H3BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)/i4+1,6+1,7+1
InChI key:InChIKey=LQLQRFGHAALLLE-XZQGXACKSA-N
SMILES:O=C1C(Br)=C[15NH][13C](=O)[15NH]1
Synonyms:- 2,4(1H,3H)-Pyrimidinedione-2-13C-1,3-15N2, 5-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Bromouracil 2-13C,15N2
CAS:Controlled ProductApplications 5-Bromo-2,4-pyrimidinedione-13C,15N2 is the isotope labelled analogue of Bromouracil, a halogenated nitrogenous base on RNA nucleosides.
References Morinaga, H., et al.: Bioorg. Med. Chem., 21, 466 (2013);Formula:C313CH3Br15N2O2Color and Shape:NeatMolecular weight:193.96
