CAS 181528-64-3
:2H,10H-Furo[3,2-i]-2-benzopyran-10-ol, octahydro-8-methoxy-4,7-dimethyl-, 10-acetate, (3aS,4R,6aS,7R,8S,10R,10aR)-
Description:
2H,10H-Furo[3,2-i]-2-benzopyran-10-ol, octahydro-8-methoxy-4,7-dimethyl-, 10-acetate, with the CAS number 181528-64-3, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and benzopyran moieties. This compound features multiple functional groups, including a methoxy group and an acetate group, which contribute to its chemical reactivity and potential biological activity. The stereochemistry of the molecule is defined by specific chiral centers, which can influence its pharmacological properties and interactions with biological systems. Typically, compounds of this nature may exhibit various activities, such as antioxidant or anti-inflammatory effects, making them of interest in medicinal chemistry. The presence of multiple methyl groups suggests potential lipophilicity, which can affect solubility and permeability in biological contexts. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in pharmaceuticals or natural product synthesis.
Formula:C16H26O5
InChI:InChI=1S/C16H26O5/c1-9-5-6-13-10(2)14(18-4)21-15(20-11(3)17)16(13)12(9)7-8-19-16/h9-10,12-15H,5-8H2,1-4H3/t9-,10-,12+,13+,14+,15+,16-/m1/s1
InChI key:InChIKey=PJRDDUABDHLSPP-QYHITDJBSA-N
SMILES:O(C(C)=O)[C@@H]1[C@]23[C@]([C@@H](C)[C@@H](OC)O1)(CC[C@@H](C)[C@@]2(CCO3)[H])[H]
Synonyms:- Artemether tetrahydrofuran acetate
- β-Artemetherfurano acetate
- 2H,10H-Furo[3,2-i]-2-benzopyran-10-ol, octahydro-8-methoxy-4,7-dimethyl-, 10-acetate, (3aS,4R,6aS,7R,8S,10R,10aR)-
- 2H,10H-Furo[3,2-i][2]benzopyran-10-ol, octahydro-8-methoxy-4,7-dimethyl-, acetate, [3aS-(3aα,4α,6aα,7β,8β,10α,10aS*)]-
- 2H,10H-Furo[3,2-i][2]benzopyran-10-ol, octahydro-8-methoxy-4,7-dimethyl-, acetate, (3aS,4R,6aS,7R,8S,10R,10aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Artemether Impurity 4
CAS:Formula:C16H26O5Color and Shape:White To Off-White SolidMolecular weight:298.38Artemether Tetrahydrofuran Acetate
CAS:Controlled ProductApplications A metabolite of Artemether (A777400) and derivative of the antimalarial drug Artemisinin (A777500). Studies suggest that it may display neurotoxicity in animals due to its interaction with iron.
References Smith, S.L. et al.: Neurotoxicology, 19, 557 (1998); Blum, W. et al.: J. Chrom. B Biomed. Sci. Appl., 710, 101 (1998);Formula:C16H26O5Color and Shape:NeatMolecular weight:298.37Artemether Tetrahydrofuran Acetate
CAS:Please enquire for more information about Artemether Tetrahydrofuran Acetate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C16H26O5Purity:Min. 95%Molecular weight:298.37 g/mol




