CAS 18156-25-7
:Bis(trimethylsilyl)sulfur diimide
Description:
Bis(trimethylsilyl)sulfur diimide, with the CAS number 18156-25-7, is a chemical compound characterized by its unique structure, which includes a sulfur atom bonded to two imide groups and two trimethylsilyl (TMS) substituents. This compound is typically a colorless to pale yellow liquid or solid, depending on its state and purity. It is known for its stability under ambient conditions, although it can decompose under extreme conditions or in the presence of moisture. Bis(trimethylsilyl)sulfur diimide is often utilized in organic synthesis, particularly in the formation of nitrogen-containing compounds, due to its ability to act as a nitrogen source. Its trimethylsilyl groups enhance its solubility in organic solvents and can facilitate various chemical reactions. Additionally, this compound is of interest in the field of materials science and catalysis, where its unique properties can be exploited for the development of new materials or catalytic processes. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H18N2SSi2
InChI:InChI=1/C6H18N2SSi2/c1-10(2,3)7-9-8-11(4,5)6/h1-6H3
SMILES:C[Si](C)(C)N=S=N[Si](C)(C)C
Synonyms:- N,N-Bis(trimethylsilyl)sulfur diimide
- N,N'-lambda~4~-sulfanediylidenebis(1,1,1-trimethylsilanamine)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

