CymitQuimica logo

CAS 181589-32-2

:

2-Ethenyl-3-ethyl-5-methylpyrazine

Description:
2-Ethenyl-3-ethyl-5-methylpyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a vinyl group (ethenyl) and two alkyl substituents (ethyl and methyl) on the pyrazine ring, contributing to its unique chemical properties and potential applications. It is typically a colorless to pale yellow liquid with a distinctive odor, often associated with roasted or nutty notes, making it of interest in flavor and fragrance industries. The presence of multiple substituents can influence its reactivity, solubility, and stability, which are important for its use in various chemical syntheses and formulations. Additionally, the compound may exhibit biological activity, although specific studies on its pharmacological properties may be limited. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-4-8-9(5-2)11-7(3)6-10-8/h4,6H,1,5H2,2-3H3
InChI key:InChIKey=YSQNQOKRWIKETP-UHFFFAOYSA-N
SMILES:C(=C)C=1C(CC)=NC(C)=CN1
Synonyms:
  • 3-Ethyl-5-methyl-2-ethenylpyrazine
  • 2-Ethenyl-3-ethyl-5-methylpyrazine
  • Pyrazine, 2-ethenyl-3-ethyl-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.