CAS 1816-91-7
:1-(2-amino-2-oxoethyl)triaza-1,2-dien-2-ium
Description:
1-(2-amino-2-oxoethyl)triaza-1,2-dien-2-ium, with the CAS number 1816-91-7, is a chemical compound characterized by its unique triazine structure, which incorporates three nitrogen atoms within a six-membered ring. This compound features an amino group and a carbonyl group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the triazine moiety suggests that it may exhibit properties such as stability under certain conditions, while also being susceptible to nucleophilic attack due to the electron-withdrawing nature of the nitrogen atoms. Additionally, the compound's ionic character, indicated by the "ium" suffix, suggests it may exist in a protonated form, enhancing its solubility in polar solvents. Its structural features make it of interest in fields such as medicinal chemistry, materials science, and agricultural chemistry, where it could serve as a precursor or intermediate in the synthesis of more complex molecules. Overall, this compound's unique characteristics position it as a valuable entity for further research and application.
Formula:C2H5N4O
InChI:InChI=1/C2H4N4O/c3-2(7)1-5-6-4/h4H,1H2,(H-,3,7)/p+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
