CymitQuimica logo

CAS 18162-82-8

:

Chloromethyltriisopropoxysilane96

Description:
Chloromethyltriisopropoxysilane, with the CAS number 18162-82-8, is an organosilicon compound characterized by its silane structure, which includes a chloromethyl group and three isopropoxy groups. This compound is typically a colorless to pale yellow liquid, exhibiting a moderate viscosity. It is known for its reactivity, particularly due to the presence of the chloromethyl group, which can participate in various chemical reactions, including nucleophilic substitution and condensation reactions. Chloromethyltriisopropoxysilane is often used as a coupling agent or a surface modifier in the production of silane-based materials, enhancing adhesion between organic and inorganic substrates. Additionally, it can serve as a precursor for the synthesis of functionalized silicates and silica materials. The compound is sensitive to moisture, and therefore, it should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of silanol groups and affect its intended applications. Proper safety measures should be observed when working with this substance due to its potential irritant properties.
Formula:C10H23ClO3Si
InChI:InChI=1/C10H23ClO3Si/c1-8(2)12-15(7-11,13-9(3)4)14-10(5)6/h8-10H,7H2,1-6H3
InChI key:SAKYAANYXZKYEK-UHFFFAOYSA-N
SMILES:CC(C)O[Si](CCl)(OC(C)C)OC(C)C
Synonyms:
  • (Chloromethyl)[Tris(Propan-2-Yloxy)]Silane
Found 4 products.