CAS 1816282-87-7
:6-(1,1,2,2,2-Pentafluoroethyl)-3-pyridinecarboxaldehyde
Description:
6-(1,1,2,2,2-Pentafluoroethyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pentafluoroethyl group. The presence of the aldehyde functional group (-CHO) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. The pentafluoroethyl substituent imparts significant fluorine content, which can enhance the compound's lipophilicity and alter its electronic properties, potentially affecting its biological activity and interactions. This compound may exhibit interesting properties such as volatility and stability under certain conditions, influenced by the fluorinated group. Its applications could span across fields such as pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often valued for their unique characteristics. Safety and handling considerations are essential due to the presence of fluorine and the aldehyde group, which can be reactive and potentially hazardous. Overall, this compound represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and applications.
Formula:C8H4F5NO
InChI:InChI=1S/C8H4F5NO/c9-7(10,8(11,12)13)6-2-1-5(4-15)3-14-6/h1-4H
InChI key:InChIKey=GIJKNSZMUDKAAR-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1=CC=C(C=O)C=N1
Synonyms:- 3-Pyridinecarboxaldehyde, 6-(1,1,2,2,2-pentafluoroethyl)-
- 6-(1,1,2,2,2-Pentafluoroethyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(Pentafluoroethyl)pyridine-3-carbaldehyde
CAS:6-(Pentafluoroethyl)pyridine-3-carbaldehyde
Molecular weight:225.12g/mol
