CAS 1816283-24-5
:2-(1,1,2,2,2-Pentafluoroethyl)-4-pyridinecarboxaldehyde
Description:
2-(1,1,2,2,2-Pentafluoroethyl)-4-pyridinecarboxaldehyde is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pentafluoroethyl group. The presence of the aldehyde functional group (-CHO) contributes to its reactivity, making it useful in various synthetic applications. The pentafluoroethyl substituent imparts significant fluorine content, which can enhance the compound's lipophilicity and stability, as well as influence its electronic properties. This compound is likely to exhibit distinct physical properties, such as a high boiling point and low volatility, due to the strong C-F bonds associated with fluorinated compounds. Additionally, its polar nature may affect its solubility in different solvents. The compound's unique characteristics make it of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds are often explored for their biological activity and potential applications in advanced materials. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing reactive functional groups and fluorinated moieties.
Formula:C8H4F5NO
InChI:InChI=1S/C8H4F5NO/c9-7(10,8(11,12)13)6-3-5(4-15)1-2-14-6/h1-4H
InChI key:InChIKey=MVIOMQMXCXKGIE-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1=CC(C=O)=CC=N1
Synonyms:- 2-(Pentafluoroethyl)pyridine-4-carbaldehyde
- 4-Pyridinecarboxaldehyde, 2-(1,1,2,2,2-pentafluoroethyl)-
- 2-(1,1,2,2,2-Pentafluoroethyl)-4-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Pentafluoroethyl)isonicotinaldehyde
CAS:2-(Pentafluoroethyl)isonicotinaldehyde
Molecular weight:225.12g/mol
