CymitQuimica logo

CAS 181647-14-3

:

4-(ethylamino)but-2-ynyl (2S)-2-cyclohexyl-2-hydroxy-2-phenyl-acetate hydrochloride

Description:
4-(Ethylamino)but-2-ynyl (2S)-2-cyclohexyl-2-hydroxy-2-phenyl-acetate hydrochloride, with the CAS number 181647-14-3, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of an ethylamino group, a butynyl chain, and a cyclohexyl moiety, along with a phenyl-acetate functional group. The hydrochloride salt form indicates that it is a hydrochloride, which typically enhances solubility in water and may influence its pharmacological properties. The compound's stereochemistry is significant, as it contains a chiral center, which can affect its biological activity and interactions with receptors. Its potential applications may include roles in medicinal chemistry or as a pharmaceutical intermediate, although specific therapeutic uses would depend on further research and development. As with many chemical substances, safety data, including toxicity and handling precautions, should be consulted before use.
Formula:C20H28ClNO3
InChI:InChI=1/C20H27NO3.ClH/c1-2-21-15-9-10-16-24-19(22)20(23,17-11-5-3-6-12-17)18-13-7-4-8-14-18;/h3,5-6,11-12,18,21,23H,2,4,7-8,13-16H2,1H3;1H/t20-;/m1./s1
SMILES:CCNCC#CCOC(=O)[C@@](c1ccccc1)(C1CCCCC1)O.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.