CAS 181657-56-7
:(1R,2R)-2-Benzyloxycyclopentylamine
Description:
(1R,2R)-2-Benzyloxycyclopentylamine is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentane ring and a benzyloxy substituent. The compound features a chiral center, indicated by the (1R,2R) configuration, which contributes to its stereochemical properties and potential biological activity. It is an amine, meaning it contains an amino group (-NH2), which can participate in various chemical reactions, including those typical of amines such as nucleophilic substitutions. The presence of the benzyloxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific receptors or enzymes. Its structural characteristics suggest that it could exhibit interesting pharmacological properties, although specific biological activities would require further investigation through experimental studies. As with many organic compounds, proper handling and safety measures should be observed due to the potential for reactivity and toxicity.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c13-11-7-4-8-12(11)14-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,13H2/t11-,12-/m1/s1
SMILES:c1ccc(cc1)CO[C@@H]1CCC[C@H]1N
Synonyms:- (1R,2R)-1-Amino-2-benzyloxycyclopentane~(1R-trans)-2-(Phenylmethoxy)cyclopentanamine
- (1R-trans)-2-(Phenylmethoxy)-cyclopentylamine
- (1R,2R)-2-(benzyloxy)cyclopentanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1R,2R)-2-(benzyloxy)cyclopentan-1-amine
CAS:(1R,2R)-2-(benzyloxy)cyclopentan-1-amine
Purity:98%Molecular weight:191.27g/mol(1R,2R)-1-Amino-2-benzyloxycyclopentane
CAS:(1R,2R)-1-Amino-2-benzyloxycyclopentane is achiral. It is a synthetic chemical that has been used as an initiator for polymerization of amines and hexafluoroisopropanol. The synthesis of this compound can be achieved through a chiral technique known as interfacial polymerization. (1R,2R)-1-Amino-2-benzyloxycyclopentane is an initiator for the production of polymers with alternating helical chains. This process relies on the presence of achiral molecules to initiate the polymerization process.
Formula:C12H17NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:191.27 g/mol




