CAS 1817-51-2
:1-PHENYL-1-HEXYN-3-OL
Description:
1-Phenyl-1-hexyne-3-ol, with the CAS number 1817-51-2, is an organic compound characterized by its alkyne functional group and a hydroxyl group. It features a phenyl group attached to a hexynyl chain, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid and is known for its aromatic characteristics due to the presence of the phenyl group. The alkyne functionality imparts reactivity, particularly in addition reactions, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and boiling point. 1-Phenyl-1-hexyne-3-ol may be utilized in various applications, including organic synthesis and as an intermediate in the production of other chemical compounds. Its properties, such as stability and reactivity, can be affected by the presence of substituents and the overall molecular structure. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H14O
InChI:InChI=1/C12H14O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h3-5,7-8,12-13H,2,6H2,1H3
SMILES:CCCC(C#Cc1ccccc1)O
Synonyms:- 1-Phenylhex-1-Yn-3-Ol
- 1-Hexyn-3-ol, 1-phenyl-
- 1-Phenyl-1-hexin-3-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenyl-1-hexyn-3-ol, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H14OPurity:97%Molecular weight:174.24



