
CAS 18171-15-8
:(3-Chloropropoxy)trimethylsilane
Description:
(3-Chloropropoxy)trimethylsilane, with the CAS number 18171-15-8, is an organosilicon compound characterized by the presence of a trimethylsilane group and a chloropropoxy functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the chlorine atom, which can participate in nucleophilic substitution reactions. The trimethylsilane moiety contributes to its hydrophobic properties, making it useful in various applications, including as a coupling agent in organic synthesis and as a reagent in the preparation of siloxane polymers. Its structure allows for the introduction of the propoxy group, which can enhance solubility in organic solvents. Additionally, (3-Chloropropoxy)trimethylsilane can be utilized in surface modification processes and as an intermediate in the synthesis of more complex silane compounds. Safety precautions should be taken when handling this substance, as it may be irritant and potentially harmful if ingested or inhaled.
Formula:C6H15ClOSi
InChI:InChI=1S/C6H15ClOSi/c1-9(2,3)8-6-4-5-7/h4-6H2,1-3H3
InChI key:InChIKey=YUOPRYLOJSXRML-UHFFFAOYSA-N
SMILES:O([Si](C)(C)C)CCCCl
Synonyms:- (3-Chloropropoxy)trimethylsilane
- 3-Chloropropyl trimethylsilyl ether
- Silane, (3-chloropropoxy)trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
