CAS 18171-50-1
:1,3-Bis(trichlorosilyl)propane
Description:
1,3-Bis(trichlorosilyl)propane, with the CAS number 18171-50-1, is an organosilicon compound characterized by its unique structure featuring two trichlorosilyl groups attached to a propane backbone. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity due to the presence of multiple chlorosilyl groups, which can readily hydrolyze in the presence of moisture, leading to the formation of silanol groups. It is often utilized in the synthesis of silicone polymers and as a coupling agent in various chemical processes. The compound exhibits properties such as low volatility and high thermal stability, making it suitable for applications in coatings, adhesives, and sealants. Additionally, its ability to form siloxane bonds allows it to enhance the adhesion and durability of materials. However, due to its chlorinated nature, it should be handled with care, as it can release hydrochloric acid upon hydrolysis, necessitating appropriate safety measures during use and storage.
Formula:C3H6Cl6Si2
InChI:InChI=1/C3H6Cl6Si2/c4-10(5,6)2-1-3-11(7,8)9/h1-3H2
SMILES:C(C[Si](Cl)(Cl)Cl)C[Si](Cl)(Cl)Cl
Synonyms:- Propane-1,3-Diylbis(Trichlorosilane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
