CAS 1817735-29-7

3,6,9,12-Tetraoxapentadec-14-ynesulfonic acid

Description:

3,6,9,12-Tetraoxapentadec-14-ynesulfonic acid is a complex organic compound characterized by its unique structure, which includes multiple ether linkages and a sulfonic acid functional group. The presence of four ether (–O–) groups contributes to its solubility in polar solvents, while the sulfonic acid group (–SO3H) enhances its acidity and makes it highly soluble in water. This compound is likely to exhibit properties typical of sulfonic acids, such as strong acidity and the ability to form salts with bases. Its structure suggests potential applications in various fields, including pharmaceuticals, materials science, and as a surfactant due to its amphiphilic nature. The presence of a triple bond (alkyne) in the carbon chain may also impart unique reactivity, allowing for further chemical modifications. Overall, 3,6,9,12-Tetraoxapentadec-14-ynesulfonic acid is a versatile compound with potential utility in both research and industrial applications.

Formula: C₁₁H₂₀O₇S

InChI: InChI=1S/C11H20O7S/c1-2-3-15-4-5-16-6-7-17-8-9-18-10-11-19(12,13)14/h1H,3-11H2,(H,12,13,14)

InChI key: InChIKey=WSJYOZNIORDONJ-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOCC#C)CCS(=O)(=O)O

Synonyms:

• 3,6,9,12-Tetraoxapentadec-14-ynesulfonic acid
• Propargyl-PEG4-sulfonic acid

3,6,9,12-Tetraoxapentadec-14-yne-1-sulfonic acid

CAS: 1817735-29-7

3,6,9,12-Tetraoxapentadec-14-yne-1-sulfonic acid

Purity: 95%

Molecular weight: 296.34g/mol

Ref: 54-OR1052359

Propargyl-PEG4-sulfonic acid

CAS: 1817735-29-7

Propargyl-PEG4-sulfonic acid is a PEG4-based linker compound utilized in PROTAC synthesis[1].

Formula: C₁₁H₂₀O₇S

Purity: 98%

Color and Shape: Solid

Molecular weight: 296.34

Ref: TM-T16631

Propargyl-PEG4-sulfonic acid

CAS: 1817735-29-7

Purity: 98%

Molecular weight: 296.09

Ref: 10-F570431

Propargyl-PEG4-sulfonic acid

CAS: 1817735-29-7

Propargyl-PEG4-sulfonic acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Propargyl-PEG4-sulfonic acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₁H₂₀O₇S

Purity: Min. 95%

Molecular weight: 296.34 g/mol

Ref: 3D-SXC73529