CAS 1817735-30-0

2,3,4,5,6-Pentafluorophenyl 3-[2-[[2-(2-propyn-1-yloxy)ethyl]dithio]ethoxy]propanoate

Description:

2,3,4,5,6-Pentafluorophenyl 3-[2-[[2-(2-propyn-1-yloxy)ethyl]dithio]ethoxy]propanoate] is a complex organic compound characterized by its unique structure, which includes a pentafluorophenyl group and a dithioether moiety. The presence of five fluorine atoms on the phenyl ring significantly enhances the compound's electronegativity and lipophilicity, potentially affecting its reactivity and solubility in various solvents. The dithioether linkage contributes to the compound's stability and may influence its biological activity. Additionally, the propanoate functional group suggests potential applications in esterification reactions or as a precursor in synthetic chemistry. This compound may exhibit interesting properties such as increased thermal stability and altered electronic characteristics due to the fluorinated aromatic system. Its complex structure indicates potential utility in medicinal chemistry or materials science, although specific applications would depend on further research into its reactivity and interactions with biological systems. Safety and handling precautions should be observed, as with any fluorinated compound, due to potential toxicity and environmental impact.

Formula: C₁₆H₁₅F₅O₄S₂

InChI: InChI=1S/C16H15F5O4S2/c1-2-4-23-6-8-26-27-9-7-24-5-3-10(22)25-16-14(20)12(18)11(17)13(19)15(16)21/h1H,3-9H2

InChI key: InChIKey=BNSPBJFNPGXULZ-UHFFFAOYSA-N

SMILES: O(C(CCOCCSSCCOCC#C)=O)C1=C(F)C(F)=C(F)C(F)=C1F

Synonyms:

• Propanoic acid, 3-[2-[[2-(2-propyn-1-yloxy)ethyl]dithio]ethoxy]-, 2,3,4,5,6-pentafluorophenyl ester
• 2,3,4,5,6-Pentafluorophenyl 3-[2-[[2-(2-propyn-1-yloxy)ethyl]dithio]ethoxy]propanoate

Propargyl-PEG1-SS-PEG1-PFP ester

CAS: 1817735-30-0

Propargyl-PEG1-SS-PEG1-PFP ester: cleavable linker with PEG for ADC synthesis.

Formula: C₁₆H₁₅F₅O₄S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 430.41

Ref: TM-T16591

Propargyl-PEG1-SS-PEG1-pfp ester

CAS: 1817735-30-0

Propargyl-PEG1-SS-PEG1-pfp ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Propargyl-PEG1-SS-PEG1-pfp ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₆H₁₅F₅O₄S₂

Purity: Min. 95%

Molecular weight: 430.4 g/mol

Ref: 3D-SXC73530