CAS 1817735-38-8

Propanoic acid, 3-[(14-sulfo-3,6,9,12-tetraoxatetradec-1-yl)oxy]-

Description:

Propanoic acid, 3-[(14-sulfo-3,6,9,12-tetraoxatetradec-1-yl)oxy]- is a complex organic compound characterized by its propanoic acid backbone, which features a sulfonate group and a polyether chain. The presence of the sulfonate group imparts significant water solubility and enhances its potential as a surfactant or emulsifying agent. The tetraoxatetradecyl moiety suggests a long hydrophilic chain, which can influence the compound's behavior in aqueous environments, making it suitable for various applications in pharmaceuticals, biochemistry, and materials science. The compound's structure indicates it may exhibit unique properties such as increased stability and reactivity due to the multiple ether linkages. Additionally, the presence of the sulfonate group may contribute to its biological activity, potentially allowing it to interact with biological membranes or proteins. Overall, this compound's characteristics make it a subject of interest for research in fields such as drug delivery systems and surface chemistry.

Formula: C₁₃H₂₆O₁₀S

InChI: InChI=1S/C13H26O10S/c14-13(15)1-2-19-3-4-20-5-6-21-7-8-22-9-10-23-11-12-24(16,17)18/h1-12H2,(H,14,15)(H,16,17,18)

InChI key: InChIKey=BNXDKCHNWPCUMT-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOCCC(O)=O)CCOCCS(=O)(=O)O

Synonyms:

• 3-[(14-Sulfo-3,6,9,12-tetraoxatetradec-1-yl)oxy]propanoic acid
• Propanoic acid, 3-[(14-sulfo-3,6,9,12-tetraoxatetradec-1-yl)oxy]-
• Carboxy-PEG5-sulfonic acid

Carboxy-PEG5-sulfonic acid

CAS: 1817735-38-8

Carboxy-PEG5-sulfonic acid, a PEG-based PROTAC linker, is utilized for the synthesis of PROTACs[1].

Formula: C₁₃H₂₆O₁₀S

Purity: 98%

Color and Shape: Solid

Molecular weight: 374.41

Ref: TM-T14870

Carboxy-PEG5-sulfonic acid

CAS: 1817735-38-8

Carboxy-PEG5-sulfonic acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Carboxy-PEG5-sulfonic acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₃H₂₆O₁₀S

Purity: Min. 95%

Molecular weight: 374.41 g/mol

Ref: 3D-SXC73538