CAS 1817735-43-5
:2-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]ethanesulfonic acid
Description:
2-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]ethanesulfonic acid, commonly referred to as a sulfonic acid derivative, is a chemical compound characterized by its complex structure that includes multiple ethoxy groups and an amino group. This compound is typically soluble in water due to the presence of the sulfonic acid functional group, which enhances its hydrophilicity. The aminoethoxy groups contribute to its potential as a biocompatible agent, making it of interest in various biochemical applications, including as a buffer in biological systems. Its sulfonic acid moiety provides acidic properties, which can be useful in regulating pH in solutions. The compound's structure suggests it may participate in hydrogen bonding, influencing its interactions with other molecules. Additionally, its unique arrangement of functional groups may impart specific reactivity and stability characteristics, making it suitable for research in fields such as medicinal chemistry and materials science. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C8H19NO6S
InChI:InChI=1S/C8H19NO6S/c9-1-2-13-3-4-14-5-6-15-7-8-16(10,11)12/h1-9H2,(H,10,11,12)
InChI key:InChIKey=KIPOASHUHFFELG-UHFFFAOYSA-N
SMILES:O(CCOCCOCCN)CCS(=O)(=O)O
Synonyms:- 2-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]ethanesulfonic acid
- Ethanesulfonic acid, 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Amino-PEG3-C2-sulfonic acid
CAS:<p>Amino-PEG3-C2-sulfonic acid is a PEG-based PROTAC linker utilized for the synthesis of PROTACs [1].</p>Formula:C8H19NO6SPurity:98%Color and Shape:SolidMolecular weight:257.31Amino-PEG3-sulfonic acid hydrochloride
CAS:<p>Amino-PEG3-sulfonic acid hydrochloride is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Amino-PEG3-sulfonic acid hydrochloride is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.</p>Formula:C8H19NO6SPurity:Min. 95%Molecular weight:257.31 g/mol



