CAS 1817735-82-2
:2-[[4-(5-Chloro-6′-methyl[2,3′-bipyridin]-3-yl)phenyl]sulfonyl]-1-(6-methyl-3-pyridinyl)ethanone
Description:
The chemical substance known as 2-[[4-(5-Chloro-6′-methyl[2,3′-bipyridin]-3-yl)phenyl]sulfonyl]-1-(6-methyl-3-pyridinyl)ethanone, with the CAS number 1817735-82-2, is a complex organic compound characterized by its intricate molecular structure. It features a sulfonyl group, which is known for its role in enhancing the solubility and reactivity of organic molecules. The presence of multiple aromatic rings, including bipyridine and phenyl moieties, suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The chloro and methyl substituents contribute to the compound's lipophilicity and may influence its biological activity. Additionally, the pyridine rings indicate potential interactions with biological targets, making this compound of interest in drug discovery. Overall, its unique structural features may confer specific properties that could be exploited in various chemical and biological applications.
Formula:C25H20ClN3O3S
InChI:InChI=1S/C25H20ClN3O3S/c1-16-3-5-19(12-27-16)24(30)15-33(31,32)22-9-7-18(8-10-22)23-11-21(26)14-29-25(23)20-6-4-17(2)28-13-20/h3-14H,15H2,1-2H3
InChI key:InChIKey=YEJWOYZOFJOOMI-UHFFFAOYSA-N
SMILES:ClC1=CC(=C(N=C1)C=2C=CC(C)=NC2)C3=CC=C(S(CC(=O)C=4C=CC(C)=NC4)(=O)=O)C=C3
Synonyms:- 2-[[4-(5-Chloro-6′-methyl[2,3′-bipyridin]-3-yl)phenyl]sulfonyl]-1-(6-methyl-3-pyridinyl)ethanone
- Ethanone, 2-[[4-(5-chloro-6′-methyl[2,3′-bipyridin]-3-yl)phenyl]sulfonyl]-1-(6-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Etoricoxib Impurity 13
CAS:Formula:C25H20ClN3O3SColor and Shape:White To Off-White SolidMolecular weight:477.96

