CAS 18178-04-6
:o-Carborane-1-carboxylic acid
Description:
o-Carborane-1-carboxylic acid is a unique organoboron compound characterized by its carborane structure, which consists of a cluster of boron and carbon atoms. This compound features a carboxylic acid functional group (-COOH) attached to the o-carborane framework, imparting distinct chemical properties. It is known for its thermal stability and resistance to oxidation, making it suitable for various applications in materials science and medicinal chemistry. The presence of the carboxylic acid group enhances its solubility in polar solvents and allows for potential reactivity in organic synthesis. Additionally, o-Carborane-1-carboxylic acid exhibits interesting properties related to its boron content, such as potential applications in neutron capture therapy for cancer treatment. Its unique structure and properties make it a subject of interest in research focused on boron-containing compounds and their applications in various fields, including pharmaceuticals and nanotechnology. Overall, o-Carborane-1-carboxylic acid represents a fascinating intersection of organic chemistry and materials science.
Formula:C3H12B10O2
InChI:InChI=1S/C3H12B10O2/c14-1(15)3-2-4(3)6(2)7(2)5(2,3)9(3)8(3,4)10(4,6)12(6,7)11(5,7,9)13(8,9,10)12/h2,4-13H,(H,14,15)
InChI key:InChIKey=SIJYFMLWIUUVMJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1234[BH]567[BH]189[BH]2%10%11[BH]3%12%13[CH]45%14[BH]6%15%16[BH]78%17[BH]%109%18[BH]%12%11%19[BH]%13%14%15[BH]%16%17%19%18
Synonyms:- 1,2-Dicarbadodecaborane-1-carboxylic acid
- 1-Carboxy-closo-1,2-dicarbadodecaborane(12)
- 1,2-Dicarbadodecaborane(12)-1-carboxylic acid
- o-Carborane-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
o-Carborane-1-carboxylic Acid
CAS:Controlled ProductFormula:C3H12B10O2Color and Shape:NeatMolecular weight:188.24
