CAS 18179-40-3

2-Hydroxy-5-iodobenzamide

Description:

2-Hydroxy-5-iodobenzamide, with the CAS number 18179-40-3, is an organic compound characterized by the presence of a hydroxyl group (-OH) and an iodo substituent on a benzamide structure. This compound features a benzene ring with an amide functional group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The hydroxyl group enhances its solubility in polar solvents, while the iodine atom can influence its biological activity and reactivity due to its size and electronegativity. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in medicinal chemistry. Additionally, the presence of both the hydroxyl and iodo groups can affect the compound's stability and interaction with other molecules. Overall, 2-Hydroxy-5-iodobenzamide is a versatile compound with potential applications in research and industry, particularly in the development of new therapeutic agents.

Formula: C₇H₆INO₂

InChI: InChI=1S/C7H6INO2/c8-4-1-2-6(10)5(3-4)7(9)11/h1-3,10H,(H2,9,11)

InChI key: InChIKey=DATPWLOVEIACJF-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(O)C=CC(I)=C1

Synonyms:

• 2-Hydroxy-5-iodobenzamide
• Benzamide, 2-hydroxy-5-iodo-
• 4-Iodosalicylamide
• Salicylamide, 5-iodo-

5-Iodosalicylamide

CAS: 18179-40-3

5-Iodosalicylamide is a chemical building block. 5-Iodosalicylamide can be reacted with appropriately functionalised aromatic compounds to afford the corresponding anilides, which have been shown to exhibit anti-fungal and bactericidal properties.

Formula: C₇H₆INO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 263.03 g/mol

Ref: 3D-FI67585