CAS 1818-12-8

2-methylestradiol

Description:

2-Methylestradiol is a synthetic estrogen and a derivative of estradiol, characterized by the presence of a methyl group at the second carbon position of the steroid nucleus. Its molecular formula is C18H24O2, and it features a phenolic hydroxyl group, which contributes to its estrogenic activity. This compound is primarily used in research and has applications in the study of hormonal regulation and reproductive health. 2-Methylestradiol exhibits high affinity for estrogen receptors, influencing various biological processes such as cell proliferation and differentiation. It is known for its potential effects on the cardiovascular system and bone metabolism. Additionally, due to its structural similarity to natural estrogens, it can mimic their effects in the body, making it a subject of interest in pharmacological studies. Safety and environmental impact assessments are crucial, as synthetic estrogens can have significant ecological effects, particularly in aquatic environments. Overall, 2-methylestradiol serves as an important compound in both medicinal chemistry and endocrinology research.

Formula: C₁₉H₂₆O₂

InChI: InChI=1/C19H26O2/c1-11-9-15-12(10-17(11)20)3-4-14-13(15)7-8-19(2)16(14)5-6-18(19)21/h9-10,13-14,16,18,20-21H,3-8H2,1-2H3/t13-,14+,16-,18-,19-/m0/s1

Synonyms:

• Estra-1,3,5(10)-triene-3,17-diol, 2-methyl-, (17beta)-
• (17Beta)-2-Methylestra-1,3,5(10)-Triene-3,17-Diol
• 2-Methylestradiol

2-Methyl Estradiol

CAS: 1818-12-8

Formula: C₁₉H₂₆O₂

Color and Shape: White To Off-White Solid

Molecular weight: 286.42

Ref: 4Z-E-0971

2-Methyl Estradiol

Controlled Product

CAS: 1818-12-8

Formula: C₁₉H₂₆O₂

Color and Shape: Neat

Molecular weight: 286.409

Ref: TR-M304665

2-Methyl Estradiol

CAS: 1818-12-8

Formula: C₁₉H₂₆O₂

Molecular weight: 286.41

Ref: ST-EA-CP-E3018