CAS 181801-29-6
:2-(4-nitrophenoxy)pyrimidine
Description:
2-(4-Nitrophenoxy)pyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The compound features a 4-nitrophenoxy group, where a nitro group (-NO2) is substituted on a phenyl ring that is connected to the pyrimidine via an ether linkage. This substitution pattern contributes to the compound's chemical reactivity and potential biological activity. The presence of the nitro group can enhance the compound's electron-withdrawing properties, influencing its solubility and interaction with other molecules. Typically, compounds like 2-(4-nitrophenoxy)pyrimidine are of interest in medicinal chemistry and material science due to their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular structure and the presence of functional groups, making it important to consult specific data for detailed applications and handling.
Formula:C10H7N3O3
InChI:InChI=1/C10H7N3O3/c14-13(15)8-2-4-9(5-3-8)16-10-11-6-1-7-12-10/h1-7H
SMILES:c1cnc(nc1)Oc1ccc(cc1)N(=O)=O
Synonyms:- Pyrimidine, 2-(4-Nitrophenoxy)-
- 2-(4-Nitrophenoxy)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
